ChemNet > CAS > 1731-79-9 dimethyl dodecanedioate
1731-79-9 dimethyl dodecanedioate
| Ürün Adı |
dimethyl dodecanedioate |
| Eş anlamlı |
Dimethyl 1,10-decanedicarboxylate; 1,10-Decanedicarboxylic acid dimethyl ester~Dodecanedioic acid dimethyl ester; Dodecanedioic acid dimethyl ester; N-(2-Chloroethyl) Pyrrolinie HCl |
| Moleküler Formülü |
C14H26O4 |
| Molekül Ağırlığı |
258.3538 |
| InChI |
InChI=1/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
| CAS kayıt numarası |
1731-79-9 |
| EINECS |
217-050-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.969g/cm3 |
| Kaynama noktası |
300.9°C at 760 mmHg |
| Kırılma indisi |
1.441 |
| Alevlenme noktası |
135°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
