ChemNet > CAS > 175137-12-9 3-chloro-4-methylthiophene-2-carbohydrazide
175137-12-9 3-chloro-4-methylthiophene-2-carbohydrazide
Ürün Adı |
3-chloro-4-methylthiophene-2-carbohydrazide |
Moleküler Formülü |
C6H7ClN2OS |
Molekül Ağırlığı |
190.6506 |
InChI |
InChI=1/C6H7ClN2OS/c1-3-2-11-5(4(3)7)6(10)9-8/h2H,8H2,1H3,(H,9,10) |
CAS kayıt numarası |
175137-12-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.415g/cm3 |
Ergime noktası |
130℃ |
Kırılma indisi |
1.613 |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|