ChemNet > CAS > 175203-19-7 1-(2-bromo-4,6-difluorophenoxy)-2-chloroethane
175203-19-7 1-(2-bromo-4,6-difluorophenoxy)-2-chloroethane
| Ürün Adı |
1-(2-bromo-4,6-difluorophenoxy)-2-chloroethane |
| Eş anlamlı |
1-Bromo-2-(2-chloroethoxy)-3,5-difluorobenzene |
| Moleküler Formülü |
C8H6BrClF2O |
| Molekül Ağırlığı |
271.4864 |
| InChI |
InChI=1/C8H6BrClF2O/c9-6-3-5(11)4-7(12)8(6)13-2-1-10/h3-4H,1-2H2 |
| CAS kayıt numarası |
175203-19-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.636g/cm3 |
| Kaynama noktası |
282.9°C at 760 mmHg |
| Kırılma indisi |
1.515 |
| Alevlenme noktası |
124.9°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
