ChemNet > CAS > 175205-18-2 N-(4-propylphenyl)thiourea
175205-18-2 N-(4-propylphenyl)thiourea
| Ürün Adı |
N-(4-propylphenyl)thiourea |
| Eş anlamlı |
1-(4-propylphenyl)thiourea |
| Moleküler Formülü |
C10H14N2S |
| Molekül Ağırlığı |
194.2966 |
| InChI |
InChI=1/C10H14N2S/c1-2-3-8-4-6-9(7-5-8)12-10(11)13/h4-7H,2-3H2,1H3,(H3,11,12,13) |
| CAS kayıt numarası |
175205-18-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.164g/cm3 |
| Ergime noktası |
165℃ |
| Kaynama noktası |
310°C at 760 mmHg |
| Kırılma indisi |
1.65 |
| Alevlenme noktası |
141.3°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S37/39:Wear suitable gloves and eye/face protection.;
|
|
