ChemNet > CAS > 175277-49-3 6-methoxypyridine-3-carbothioamide
175277-49-3 6-methoxypyridine-3-carbothioamide
Ürün Adı |
6-methoxypyridine-3-carbothioamide |
Eş anlamlı |
6-methoxy-3-Pyridinecarbothioamide |
Moleküler Formülü |
C7H8N2OS |
Molekül Ağırlığı |
168.2162 |
InChI |
InChI=1/C7H8N2OS/c1-10-6-3-2-5(4-9-6)7(8)11/h2-4H,1H3,(H2,8,11) |
CAS kayıt numarası |
175277-49-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.262g/cm3 |
Ergime noktası |
150℃ |
Kaynama noktası |
292.5°C at 760 mmHg |
Kırılma indisi |
1.626 |
Alevlenme noktası |
130.7°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|