ChemNet > CAS > 175277-60-8 1-(2-Cyanoethyl)-3-(trifluoromethyl)pyrid-2(1H)-one
175277-60-8 1-(2-Cyanoethyl)-3-(trifluoromethyl)pyrid-2(1H)-one
| Ürün Adı |
1-(2-Cyanoethyl)-3-(trifluoromethyl)pyrid-2(1H)-one |
| Eş anlamlı |
3-[2-Oxo-3-(trifluoromethyl)-1,2-dihydropyridin-1-yl]propanenitrile; 1-(2-Cyanoethyl)-3-(trifluoromethyl)-2(1H)-pyridone; [(2,4-difluorophenyl)sulfanyl]acetonitrile |
| Moleküler Formülü |
C8H5F2NS |
| Molekül Ağırlığı |
185.1938 |
| InChI |
InChI=1/C8H5F2NS/c9-6-1-2-8(7(10)5-6)12-4-3-11/h1-2,5H,4H2 |
| CAS kayıt numarası |
175277-60-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.31g/cm3 |
| Ergime noktası |
88-89℃ |
| Kaynama noktası |
242.4°C at 760 mmHg |
| Kırılma indisi |
1.542 |
| Alevlenme noktası |
100.4°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|
