ChemNet > CAS > 17700-09-3 2,3,4-Trichloronitrobenzene
17700-09-3 2,3,4-Trichloronitrobenzene
| Ürün Adı |
2,3,4-Trichloronitrobenzene |
| Eş anlamlı |
1-Nitro-2,3,4-trichlorobenzene; 2,3,4-trichloronitrobenzole; 1,2,3-trichloro-4-nitrobenzene |
| Moleküler Formülü |
C6H2Cl3NO2 |
| Molekül Ağırlığı |
226.4446 |
| InChI |
InChI=1/C6H2Cl3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| CAS kayıt numarası |
17700-09-3 |
| EINECS |
241-705-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.651g/cm3 |
| Ergime noktası |
55-56℃ |
| Kaynama noktası |
296.2°C at 760 mmHg |
| Kırılma indisi |
1.609 |
| Alevlenme noktası |
133°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Güvenlik Açıklaması |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
