ChemNet > CAS > 1817-47-6 4-Isopropylnitrobenzene
1817-47-6 4-Isopropylnitrobenzene
| Ürün Adı |
4-Isopropylnitrobenzene |
| Eş anlamlı |
4-Isopropylnitrobenzene~4-Nitrocumene; 1-(1-methylethyl)-4-nitro-benzene; 4-Nitrocumene; 1-Isopropyl-4-Nitrobenzene; 4-Nitro-Isopropylbenzene; 1-nitro-4-(propan-2-yl)benzene |
| Moleküler Formülü |
C9H11NO2 |
| Molekül Ağırlığı |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3 |
| CAS kayıt numarası |
1817-47-6 |
| EINECS |
217-326-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.091g/cm3 |
| Kaynama noktası |
236.4°C at 760 mmHg |
| Kırılma indisi |
1.533 |
| Alevlenme noktası |
99.9°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
