ChemNet > CAS > 18355-80-1 2,3-difluoroacetophenone
18355-80-1 2,3-difluoroacetophenone
| Ürün Adı |
2,3-difluoroacetophenone |
| Eş anlamlı |
2',3'-difluoroacetophenone; 1-(2,3-difluorophenyl)ethanone |
| Moleküler Formülü |
C8H6F2O |
| Molekül Ağırlığı |
156.1294 |
| InChI |
InChI=1/C8H6F2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| CAS kayıt numarası |
18355-80-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.206g/cm3 |
| Kaynama noktası |
193.4°C at 760 mmHg |
| Kırılma indisi |
1.472 |
| Alevlenme noktası |
71.5°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
