ChemNet > CAS > 18711-13-2 4,7-Dichloroisatin
18711-13-2 4,7-Dichloroisatin
Ürün Adı |
4,7-Dichloroisatin |
Eş anlamlı |
4,7-dichloro-1H-indole-2,3-dione; 4,7-Dichloroindoline-2,3-dione |
Moleküler Formülü |
C8H3Cl2NO2 |
Molekül Ağırlığı |
216.0209 |
InChI |
InChI=1/C8H3Cl2NO2/c9-3-1-2-4(10)6-5(3)7(12)8(13)11-6/h1-2H,(H,11,12,13) |
CAS kayıt numarası |
18711-13-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.643g/cm3 |
Ergime noktası |
251-254℃ |
Kırılma indisi |
1.637 |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|