ChemNet > CAS > 187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
| Ürün Adı |
1-(1-benzofuran-3-yl)-2-bromo-1-ethanone |
| Eş anlamlı |
[2,4-bis(methylsulfonyl)phenyl]hydrazine; 1-(1-benzofuran-3-yl)-2-bromoethanone |
| Moleküler Formülü |
C10H7BrO2 |
| Molekül Ağırlığı |
239.0654 |
| InChI |
InChI=1/C10H7BrO2/c11-5-9(12)8-6-13-10-4-2-1-3-7(8)10/h1-4,6H,5H2 |
| CAS kayıt numarası |
187657-92-7 |
| EINECS |
260-718-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.582g/cm3 |
| Ergime noktası |
136℃ |
| Kaynama noktası |
306.8°C at 760 mmHg |
| Kırılma indisi |
1.636 |
| Alevlenme noktası |
139.3°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
