ChemNet > CAS > 191-48-0 decacyclene
191-48-0 decacyclene
Ürün Adı |
decacyclene |
Eş anlamlı |
benzo(a,a,a)triacenaphthylene; diacenaphtho[1,2-j:1',2'-l]fluoranthene |
Moleküler Formülü |
C36H18 |
Molekül Ağırlığı |
450.5281 |
InChI |
InChI=1/C36H18/c1-7-19-8-2-14-23-28(19)22(13-1)31-32(23)34-26-17-5-11-21-12-6-18-27(30(21)26)36(34)35-25-16-4-10-20-9-3-15-24(29(20)25)33(31)35/h1-18H |
CAS kayıt numarası |
191-48-0 |
EINECS |
205-889-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.467g/cm3 |
Ergime noktası |
300℃ |
Kırılma indisi |
2.116 |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|