ChemNet > CAS > 19241-39-5 2-Bromo-4-methylisothiocyanatobenzene
19241-39-5 2-Bromo-4-methylisothiocyanatobenzene
| Ürün Adı |
2-Bromo-4-methylisothiocyanatobenzene |
| Eş anlamlı |
2-Bromo-4-methylphenyl isothiocyanate; 2-bromo-1-isothiocyanato-4-methylbenzene |
| Moleküler Formülü |
C8H6BrNS |
| Molekül Ağırlığı |
228.1089 |
| InChI |
InChI=1/C8H6BrNS/c1-6-2-3-8(10-5-11)7(9)4-6/h2-4H,1H3 |
| CAS kayıt numarası |
19241-39-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.44g/cm3 |
| Kaynama noktası |
305.7°C at 760 mmHg |
| Kırılma indisi |
1.608 |
| Alevlenme noktası |
138.7°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
