ChemNet > CAS > 19250-09-0 1-(3,4-Dichlorophenyl)-2-thiourea
19250-09-0 1-(3,4-Dichlorophenyl)-2-thiourea
Ürün Adı |
1-(3,4-Dichlorophenyl)-2-thiourea |
Eş anlamlı |
3,4-Dichlorophenylthiourea; 1-(3,4-dichlorophenyl)thiourea |
Moleküler Formülü |
C7H6Cl2N2S |
Molekül Ağırlığı |
221.1069 |
InChI |
InChI=1/C7H6Cl2N2S/c8-5-2-1-4(3-6(5)9)11-7(10)12/h1-3H,(H3,10,11,12) |
CAS kayıt numarası |
19250-09-0 |
EINECS |
242-919-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.563g/cm3 |
Ergime noktası |
210-213℃ |
Kaynama noktası |
327.7°C at 760 mmHg |
Kırılma indisi |
1.73 |
Alevlenme noktası |
152°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|