ChemNet > CAS > 1968-40-7 Ethyl pent-4-enoate
1968-40-7 Ethyl pent-4-enoate
| Ürün Adı |
Ethyl pent-4-enoate |
| Eş anlamlı |
Ethyl pent-4-enoate, (Ethyl allylacetate; Pent-4-enoic aci; Ethyl allylacetate; 4-Pentenoic acid ethyl ester; Ethyl 4-pentenoate |
| Moleküler Formülü |
C7H12O2 |
| Molekül Ağırlığı |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-3-5-6-7(8)9-4-2/h3H,1,4-6H2,2H3 |
| CAS kayıt numarası |
1968-40-7 |
| EINECS |
217-818-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.898g/cm3 |
| Kaynama noktası |
122.8°C at 760 mmHg |
| Kırılma indisi |
1.418 |
| Alevlenme noktası |
33.7°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
