ChemNet > CAS > 589-98-0;20296-29-1 3-Octanol
589-98-0;20296-29-1 3-Octanol
Ürün Adı |
3-Octanol |
Eş anlamlı |
DL-3-Octanol; ethylpentylcarbinol; n-Amyl ethyl carbinol; Ethyl n-pentyl carbinol; (3S)-octan-3-ol; (±)-octan-3-ol; (3R)-octan-3-ol |
Moleküler Formülü |
C8H18O |
Molekül Ağırlığı |
130.2279 |
InChI |
InChI=1/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
CAS kayıt numarası |
589-98-0;20296-29-1 |
EINECS |
209-667-4 |
Moleküler Yapısı |
|
Yoğunluk |
0.821g/cm3 |
Ergime noktası |
-45℃ |
Kaynama noktası |
169°C at 760 mmHg |
Kırılma indisi |
1.426 |
Alevlenme noktası |
65.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|