ChemNet > CAS > 20426-12-4 4-Hydroxychalcone
20426-12-4 4-Hydroxychalcone
| Ürün Adı |
4-Hydroxychalcone |
| Eş anlamlı |
4-Hydroxybenzylideneacetophenone; 3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
| Moleküler Formülü |
C15H12O2 |
| Molekül Ağırlığı |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11,16H/b11-8+ |
| CAS kayıt numarası |
20426-12-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.191g/cm3 |
| Ergime noktası |
183-185℃ |
| Kaynama noktası |
394.9°C at 760 mmHg |
| Kırılma indisi |
1.653 |
| Alevlenme noktası |
168.6°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
