ChemNet > CAS > 205178-80-9 2-bromo-1-(4-chloro-3-methylphenyl)ethan-1-one
205178-80-9 2-bromo-1-(4-chloro-3-methylphenyl)ethan-1-one
| Ürün Adı |
2-bromo-1-(4-chloro-3-methylphenyl)ethan-1-one |
| Eş anlamlı |
2-bromo-1-(4-chloro-3-methylphenyl)ethanone |
| Moleküler Formülü |
C9H8BrClO |
| Molekül Ağırlığı |
247.5162 |
| InChI |
InChI=1/C9H8BrClO/c1-6-4-7(9(12)5-10)2-3-8(6)11/h2-4H,5H2,1H3 |
| CAS kayıt numarası |
205178-80-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.524g/cm3 |
| Ergime noktası |
52℃ |
| Kaynama noktası |
312.329°C at 760 mmHg |
| Kırılma indisi |
1.576 |
| Alevlenme noktası |
142.692°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
