ChemNet > CAS > 2052-06-4 4-Bromo-N,N-diethylaniline
2052-06-4 4-Bromo-N,N-diethylaniline
| Ürün Adı |
4-Bromo-N,N-diethylaniline |
| Eş anlamlı |
Benzenamine, 4-bromo-N,N-diethyl-; N,N-Diethyl-p-bromoaniline; NSC 8071; p-Bromo-N,N-diethylaniline; Aniline, p-bromo-N,N-diethyl- (8CI); p-N,Nddiethylaniline |
| Moleküler Formülü |
C10H14BrN |
| Molekül Ağırlığı |
228.1289 |
| InChI |
InChI=1/C10H14BrN/c1-3-12(4-2)10-7-5-9(11)6-8-10/h5-8H,3-4H2,1-2H3 |
| CAS kayıt numarası |
2052-06-4 |
| EINECS |
218-140-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.291g/cm3 |
| Kaynama noktası |
270°C at 760 mmHg |
| Kırılma indisi |
1.564 |
| Alevlenme noktası |
125.1°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
