ChemNet > CAS > 207974-14-9 4-Bromo-2,5-difluorobenzenesulphonyl chloride
207974-14-9 4-Bromo-2,5-difluorobenzenesulphonyl chloride
Ürün Adı |
4-Bromo-2,5-difluorobenzenesulphonyl chloride |
Eş anlamlı |
4-bromo-2,5-difluorobenzenesulfonyl chloride; 3,4-dihydro-2H-chromen-2-ylmethanol; 1,3-difluoro-2-isothiocyanatobenzene |
Moleküler Formülü |
C7H3F2NS |
Molekül Ağırlığı |
171.1672 |
InChI |
InChI=1/C7H3F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
CAS kayıt numarası |
207974-14-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.26g/cm3 |
Ergime noktası |
37℃ |
Kaynama noktası |
221.6°C at 760 mmHg |
Kırılma indisi |
1.536 |
Alevlenme noktası |
87.8°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|