ChemNet > CAS > 207986-25-2 alpha-Bromo-4-(diethylamino)acetophenone
207986-25-2 alpha-Bromo-4-(diethylamino)acetophenone
Ürün Adı |
alpha-Bromo-4-(diethylamino)acetophenone |
Eş anlamlı |
4-(Diethylamino)phenacyl bromide; 2-bromo-1-[4-(diethylamino)phenyl]ethanone |
Moleküler Formülü |
C12H16BrNO |
Molekül Ağırlığı |
270.1655 |
InChI |
InChI=1/C12H16BrNO/c1-3-14(4-2)11-7-5-10(6-8-11)12(15)9-13/h5-8H,3-4,9H2,1-2H3 |
CAS kayıt numarası |
207986-25-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.316g/cm3 |
Kaynama noktası |
357.7°C at 760 mmHg |
Kırılma indisi |
1.572 |
Alevlenme noktası |
170.1°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|