ChemNet > CAS > 20949-81-9 2-phenyl-1,3-thiazole-4-carbaldehyde
20949-81-9 2-phenyl-1,3-thiazole-4-carbaldehyde
Ürün Adı |
2-phenyl-1,3-thiazole-4-carbaldehyde |
Eş anlamlı |
2-phenylthiazole-4-carbaldehyde |
Moleküler Formülü |
C10H7NOS |
Molekül Ağırlığı |
189.2337 |
InChI |
InChI=1/C10H7NOS/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-7H |
CAS kayıt numarası |
20949-81-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.269g/cm3 |
Ergime noktası |
45℃ |
Kaynama noktası |
353°C at 760 mmHg |
Kırılma indisi |
1.645 |
Alevlenme noktası |
167.3°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|