ChemNet > CAS > 2103-91-5 2-Amino-4-(p-tolyl)thiazole
2103-91-5 2-Amino-4-(p-tolyl)thiazole
| Ürün Adı |
2-Amino-4-(p-tolyl)thiazole |
| Eş anlamlı |
4-(4-Methylphenyl)-2-thiazolamine; 4-(4-methylphenyl)-1,3-thiazol-2-amine |
| Moleküler Formülü |
C10H10N2S |
| Molekül Ağırlığı |
190.2648 |
| InChI |
InChI=1/C10H10N2S/c1-7-2-4-8(5-3-7)9-6-13-10(11)12-9/h2-6H,1H3,(H2,11,12) |
| CAS kayıt numarası |
2103-91-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.219g/cm3 |
| Ergime noktası |
132-136℃ |
| Kaynama noktası |
369.4°C at 760 mmHg |
| Kırılma indisi |
1.642 |
| Alevlenme noktası |
177.2°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
