ChemNet > CAS > 2113-58-8 3-Nitrobiphenyl
2113-58-8 3-Nitrobiphenyl
Ürün Adı |
3-Nitrobiphenyl |
Eş anlamlı |
3-Nitrodiphenyl |
Moleküler Formülü |
C12H9NO2 |
Molekül Ağırlığı |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
CAS kayıt numarası |
2113-58-8 |
EINECS |
218-305-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.196g/cm3 |
Ergime noktası |
56-60℃ |
Kaynama noktası |
339°C at 760 mmHg |
Kırılma indisi |
1.605 |
Alevlenme noktası |
161.4°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R40:Possible risks of irreversible effects.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|