ChemNet > CAS > 2114-39-8 2-Bromo-1-phenylpropane
2114-39-8 2-Bromo-1-phenylpropane
Ürün Adı |
2-Bromo-1-phenylpropane |
Eş anlamlı |
(2-Bromopropyl)benzene |
Moleküler Formülü |
C9H11Br |
Molekül Ağırlığı |
199.0876 |
InChI |
InChI=1/C9H11Br/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
CAS kayıt numarası |
2114-39-8 |
EINECS |
218-315-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.307g/cm3 |
Kaynama noktası |
228°C at 760 mmHg |
Kırılma indisi |
1.544 |
Alevlenme noktası |
90.6°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|