ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
Ürün Adı |
3-(trifluoromethyl)phenoxyacetonitrile |
Eş anlamlı |
2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
Moleküler Formülü |
C8H7FO3 |
Molekül Ağırlığı |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
CAS kayıt numarası |
2145-31-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.309g/cm3 |
Kaynama noktası |
268.9°C at 760 mmHg |
Kırılma indisi |
1.526 |
Alevlenme noktası |
116.4°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|