ChemNet > CAS > 214894-89-0 5-(Bromomethyl)-2,3-dihydro-1,4-benzodioxine
214894-89-0 5-(Bromomethyl)-2,3-dihydro-1,4-benzodioxine
| Ürün Adı |
5-(Bromomethyl)-2,3-dihydro-1,4-benzodioxine |
| Eş anlamlı |
8-(bromomethyl)-2,3-dihydro-1,4-benzodioxine |
| Moleküler Formülü |
C9H9BrO2 |
| Molekül Ağırlığı |
229.0706 |
| InChI |
InChI=1/C9H9BrO2/c10-6-7-2-1-3-8-9(7)12-5-4-11-8/h1-3H,4-6H2 |
| CAS kayıt numarası |
214894-89-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.549g/cm3 |
| Ergime noktası |
69.4℃ |
| Kaynama noktası |
295.7°C at 760 mmHg |
| Kırılma indisi |
1.586 |
| Alevlenme noktası |
137.9°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
