ChemNet > CAS > 215-58-7 1,2,3,4-Dibenzanthracene
215-58-7 1,2,3,4-Dibenzanthracene
Ürün Adı |
1,2,3,4-Dibenzanthracene |
Eş anlamlı |
Dibenz[a,c]anthracene; dibenz(a,c)anthracene; 1,2:3,4-dibenzanthracene; Benztriphenylene; 2,3-Benztriphenylene; benzo[f]tetraphene |
Moleküler Formülü |
C22H14 |
Molekül Ağırlığı |
278.3466 |
InChI |
InChI=1/C22H14/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-14H |
CAS kayıt numarası |
215-58-7 |
EINECS |
205-920-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.232g/cm3 |
Ergime noktası |
202-207℃ |
Kaynama noktası |
518°C at 760 mmHg |
Kırılma indisi |
1.811 |
Alevlenme noktası |
264.5°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R40:Possible risks of irreversible effects.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|