ChemNet > CAS > 2150-89-2 N-(3-Chlorophenyl)urethane
2150-89-2 N-(3-Chlorophenyl)urethane
Ürün Adı |
N-(3-Chlorophenyl)urethane |
Eş anlamlı |
Ethyl 3-chlorocarbanilate~Ethyl N-(3-chlorophenyl) carbamate; ethyl (3-chlorophenyl)carbamate |
Moleküler Formülü |
C9H10ClNO2 |
Molekül Ağırlığı |
199.6342 |
InChI |
InChI=1/C9H10ClNO2/c1-2-13-9(12)11-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3,(H,11,12) |
CAS kayıt numarası |
2150-89-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.268g/cm3 |
Kaynama noktası |
238.5°C at 760 mmHg |
Kırılma indisi |
1.572 |
Alevlenme noktası |
98°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|