ChemNet > CAS > 2150-89-2 N-(3-Chlorophenyl)urethane
2150-89-2 N-(3-Chlorophenyl)urethane
| Ürün Adı |
N-(3-Chlorophenyl)urethane |
| Eş anlamlı |
Ethyl 3-chlorocarbanilate~Ethyl N-(3-chlorophenyl) carbamate; ethyl (3-chlorophenyl)carbamate |
| Moleküler Formülü |
C9H10ClNO2 |
| Molekül Ağırlığı |
199.6342 |
| InChI |
InChI=1/C9H10ClNO2/c1-2-13-9(12)11-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3,(H,11,12) |
| CAS kayıt numarası |
2150-89-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.268g/cm3 |
| Kaynama noktası |
238.5°C at 760 mmHg |
| Kırılma indisi |
1.572 |
| Alevlenme noktası |
98°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
