ChemNet > CAS > 21581-45-3 3,4-Dichlorophenethylamine
21581-45-3 3,4-Dichlorophenethylamine
| Ürün Adı |
3,4-Dichlorophenethylamine |
| Eş anlamlı |
2-(3,4-dichlorophenyl)ethanamine; 2-(3,4-dichlorophenyl)ethanaminium; 3,4-Dichloro-benzeneethanamine |
| Moleküler Formülü |
C8H10Cl2N |
| Molekül Ağırlığı |
191.0772 |
| InChI |
InChI=1/C8H9Cl2N/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5H,3-4,11H2/p+1 |
| CAS kayıt numarası |
21581-45-3 |
| Moleküler Yapısı |
|
| Kaynama noktası |
268.8°C at 760 mmHg |
| Alevlenme noktası |
116.4°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
