ChemNet > CAS > 21667-62-9 3-Chlorobenzoylacetonitrile,
21667-62-9 3-Chlorobenzoylacetonitrile,
| Ürün Adı |
3-Chlorobenzoylacetonitrile, |
| Eş anlamlı |
3-Chlorobenzoylacetonitrile; 3-(3-Chlorophenyl)-3-oxopropanenitrile |
| Moleküler Formülü |
C9H6ClNO |
| Molekül Ağırlığı |
179.603 |
| InChI |
InChI=1/C9H6ClNO/c10-8-3-1-2-7(6-8)9(12)4-5-11/h1-3,6H,4H2 |
| CAS kayıt numarası |
21667-62-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.257g/cm3 |
| Ergime noktası |
78℃ |
| Kaynama noktası |
347.1°C at 760 mmHg |
| Kırılma indisi |
1.553 |
| Alevlenme noktası |
163.7°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
