ChemNet > CAS > 2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
| Ürün Adı |
4-Chloro-alpha-methylphenylacetonitrile |
| Eş anlamlı |
2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
| Moleküler Formülü |
C9H8ClN |
| Molekül Ağırlığı |
165.6195 |
| InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
| CAS kayıt numarası |
2184-88-5 |
| EINECS |
218-569-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.143g/cm3 |
| Kaynama noktası |
260.3°C at 760 mmHg |
| Kırılma indisi |
1.537 |
| Alevlenme noktası |
104°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|
