ChemNet > CAS > 220141-73-1 3,4,5-trifluoroacetophenone
220141-73-1 3,4,5-trifluoroacetophenone
Ürün Adı |
3,4,5-trifluoroacetophenone |
Eş anlamlı |
3',4',5'-Trifluoroacetophenone; 1-(3,4,5-trifluorophenyl)ethanone |
Moleküler Formülü |
C8H5F3O |
Molekül Ağırlığı |
174.1199 |
InChI |
InChI=1/C8H5F3O/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
CAS kayıt numarası |
220141-73-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.303g/cm3 |
Kaynama noktası |
208.8°C at 760 mmHg |
Kırılma indisi |
1.455 |
Alevlenme noktası |
72.5°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|