ChemNet > CAS > 22236-04-0 2-(difluoromethoxy)aniline
22236-04-0 2-(difluoromethoxy)aniline
| Ürün Adı |
2-(difluoromethoxy)aniline |
| Eş anlamlı |
2-Difluoromethoxyaniline |
| Moleküler Formülü |
C7H7F2NO |
| Molekül Ağırlığı |
159.1334 |
| InChI |
InChI=1/C7H7F2NO/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2 |
| CAS kayıt numarası |
22236-04-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.253g/cm3 |
| Kaynama noktası |
209.8°C at 760 mmHg |
| Kırılma indisi |
1.501 |
| Alevlenme noktası |
80.7°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
