ChemNet > CAS > 226396-32-3 2,3,4-Trifluorophenylboronic acid
226396-32-3 2,3,4-Trifluorophenylboronic acid
| Ürün Adı |
2,3,4-Trifluorophenylboronic acid |
| Moleküler Formülü |
C6H4BF3O2 |
| Molekül Ağırlığı |
175.901 |
| InChI |
InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
| CAS kayıt numarası |
226396-32-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.44g/cm3 |
| Ergime noktası |
229-235℃ |
| Kaynama noktası |
260.2°C at 760 mmHg |
| Kırılma indisi |
1.465 |
| Alevlenme noktası |
111.2°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
