ChemNet > CAS > 226717-83-5 2,3,5-trifluorobenzyl bromide
226717-83-5 2,3,5-trifluorobenzyl bromide
| Ürün Adı |
2,3,5-trifluorobenzyl bromide |
| Eş anlamlı |
alpha-Bromo-2,3,5-trifluorotoluene; 1-(bromomethyl)-2,3,5-trifluorobenzene |
| Moleküler Formülü |
C7H4BrF3 |
| Molekül Ağırlığı |
225.0059 |
| InChI |
InChI=1/C7H4BrF3/c8-3-4-1-5(9)2-6(10)7(4)11/h1-2H,3H2 |
| CAS kayıt numarası |
226717-83-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.71g/cm3 |
| Kaynama noktası |
181.1°C at 760 mmHg |
| Kırılma indisi |
1.502 |
| Alevlenme noktası |
69.1°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
