ChemNet > CAS > 22711-24-6 1-(4-nitrophenyl)-2-phenylethane-1,2-dione
22711-24-6 1-(4-nitrophenyl)-2-phenylethane-1,2-dione
Ürün Adı |
1-(4-nitrophenyl)-2-phenylethane-1,2-dione |
Moleküler Formülü |
C14H9NO4 |
Molekül Ağırlığı |
255.2256 |
InChI |
InChI=1/C14H9NO4/c16-13(10-4-2-1-3-5-10)14(17)11-6-8-12(9-7-11)15(18)19/h1-9H |
CAS kayıt numarası |
22711-24-6 |
Moleküler Yapısı |
|
Yoğunluk |
1.327g/cm3 |
Ergime noktası |
130℃ |
Kaynama noktası |
444.9°C at 760 mmHg |
Kırılma indisi |
1.623 |
Alevlenme noktası |
220.9°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|