ChemNet > CAS > 229-87-8 Phenanthridine
229-87-8 Phenanthridine
Ürün Adı |
Phenanthridine |
Eş anlamlı |
Phenanthridine; 3,4-Benzoquinoline; Phenanthridine, (Benzo[c]quinoline) |
Moleküler Formülü |
C13H9N |
Molekül Ağırlığı |
179.2173 |
InChI |
InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
CAS kayıt numarası |
229-87-8 |
EINECS |
205-934-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.187g/cm3 |
Ergime noktası |
104-107℃ |
Kaynama noktası |
340.8°C at 760 mmHg |
Kırılma indisi |
1.726 |
Alevlenme noktası |
155.9°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R40:Possible risks of irreversible effects.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|