ChemNet > CAS > 23068-44-2 2,5-Dimethylphenethylamine
23068-44-2 2,5-Dimethylphenethylamine
| Ürün Adı |
2,5-Dimethylphenethylamine |
| Eş anlamlı |
Phenethylamine, 2,5-dimethyl-; 4-12-00-02847 (Beilstein Handbook Reference); BRN 2962371; 2-(2,5-dimethylphenyl)ethanamine; 2-(2,5-dimethylphenyl)ethanaminium |
| Moleküler Formülü |
C10H16N |
| Molekül Ağırlığı |
150.2402 |
| InChI |
InChI=1/C10H15N/c1-8-3-4-9(2)10(7-8)5-6-11/h3-4,7H,5-6,11H2,1-2H3/p+1 |
| CAS kayıt numarası |
23068-44-2 |
| Moleküler Yapısı |
|
| Kaynama noktası |
240.7°C at 760 mmHg |
| Alevlenme noktası |
99.9°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
