ChemNet > CAS > 23173-76-4 1-Benzyl-4-(ethoxycarbonylmethyl)piperazine
23173-76-4 1-Benzyl-4-(ethoxycarbonylmethyl)piperazine
| Ürün Adı |
1-Benzyl-4-(ethoxycarbonylmethyl)piperazine |
| Eş anlamlı |
N-Benzyl-N-(carboethoxymethyl)piperazine; ethyl (4-benzylpiperazin-1-yl)acetate; ethyl 2-(4-benzylpiperazin-1-yl)acetate |
| Moleküler Formülü |
C15H22N2O2 |
| Molekül Ağırlığı |
262.3474 |
| InChI |
InChI=1/C15H22N2O2/c1-2-19-15(18)13-17-10-8-16(9-11-17)12-14-6-4-3-5-7-14/h3-7H,2,8-13H2,1H3 |
| CAS kayıt numarası |
23173-76-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.088g/cm3 |
| Kaynama noktası |
360.7°C at 760 mmHg |
| Kırılma indisi |
1.535 |
| Alevlenme noktası |
172°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
