ChemNet > CAS > 23384-72-7 3,4-difluoropropiophenone
23384-72-7 3,4-difluoropropiophenone
| Ürün Adı |
3,4-difluoropropiophenone |
| Eş anlamlı |
3',4'-Difluoropropiophenone; 1-(3,4-difluorophenyl)propan-1-one |
| Moleküler Formülü |
C9H8F2O |
| Molekül Ağırlığı |
170.156 |
| InChI |
InChI=1/C9H8F2O/c1-2-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3 |
| CAS kayıt numarası |
23384-72-7 |
| EINECS |
245-627-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.166g/cm3 |
| Kaynama noktası |
225°C at 760 mmHg |
| Kırılma indisi |
1.472 |
| Alevlenme noktası |
84.8°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
