ChemNet > CAS > 23583-21-3 Benzylaminopropionicacidethylester
23583-21-3 Benzylaminopropionicacidethylester
Ürün Adı |
Benzylaminopropionicacidethylester |
Eş anlamlı |
N-Benzyl-3-aminopropionic acid ethyl ester; N-Benzyl-beta-alanine ethyl ester; Bzl-beta-Ala-OEt~Ethyl 3-(benzylamino)propionate; ethyl N-benzyl-beta-alaninate; Ethyl 3-(Benzylamino)Propanoate |
Moleküler Formülü |
C12H17NO2 |
Molekül Ağırlığı |
207.2689 |
InChI |
InChI=1/C12H17NO2/c1-2-15-12(14)8-9-13-10-11-6-4-3-5-7-11/h3-7,13H,2,8-10H2,1H3 |
CAS kayıt numarası |
23583-21-3 |
EINECS |
245-759-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.033g/cm3 |
Kaynama noktası |
307.2°C at 760 mmHg |
Kırılma indisi |
1.507 |
Alevlenme noktası |
139.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|