ChemNet > CAS > 2393-97-7 Bis-(4-chlorophenylthio)methane
2393-97-7 Bis-(4-chlorophenylthio)methane
| Ürün Adı |
Bis-(4-chlorophenylthio)methane |
| Eş anlamlı |
Bis(4-chlorophenylthio)methane; 1,1'-(methanediyldisulfanediyl)bis(4-chlorobenzene) |
| Moleküler Formülü |
C13H10Cl2S2 |
| Molekül Ağırlığı |
301.2545 |
| InChI |
InChI=1/C13H10Cl2S2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
| CAS kayıt numarası |
2393-97-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.38g/cm3 |
| Ergime noktası |
45-48℃ |
| Kaynama noktası |
420.9°C at 760 mmHg |
| Kırılma indisi |
1.677 |
| Alevlenme noktası |
192.5°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
