ChemNet > CAS > 2432-42-0 S-Ethyl thiopropionate
2432-42-0 S-Ethyl thiopropionate
| Ürün Adı |
S-Ethyl thiopropionate |
| Eş anlamlı |
Thiopropionic acid S-ethyl ester; S-ethyl propanethioate |
| Moleküler Formülü |
C5H10OS |
| Molekül Ağırlığı |
118.1973 |
| InChI |
InChI=1/C5H10OS/c1-3-5(6)7-4-2/h3-4H2,1-2H3 |
| CAS kayıt numarası |
2432-42-0 |
| EINECS |
219-405-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.967g/cm3 |
| Kaynama noktası |
141.4°C at 760 mmHg |
| Kırılma indisi |
1.456 |
| Alevlenme noktası |
36°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R10:Flammable.;
|
| Güvenlik Açıklaması |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
