ChemNet > CAS > 24662-24-6 1-benzothiophene-3-carbothioamide
24662-24-6 1-benzothiophene-3-carbothioamide
Ürün Adı |
1-benzothiophene-3-carbothioamide |
Moleküler Formülü |
C9H7NS2 |
Molekül Ağırlığı |
193.2886 |
InChI |
InChI=1/C9H7NS2/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5H,(H2,10,11) |
CAS kayıt numarası |
24662-24-6 |
Moleküler Yapısı |
|
Yoğunluk |
1.384g/cm3 |
Ergime noktası |
109℃ |
Kaynama noktası |
364.8°C at 760 mmHg |
Kırılma indisi |
1.781 |
Alevlenme noktası |
174.4°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|