ChemNet > CAS > 24800-44-0 Tripropylene glycol
24800-44-0 Tripropylene glycol
| Ürün Adı |
Tripropylene glycol |
| Eş anlamlı |
Tripropylene glycol (mixture of isomers); Tripropyleneglycol,90%; Tripropyleneglycol; TPG; 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol; 3,3'-[propane-1,2-diylbis(oxy)]dipropan-1-ol; tripropylene glycol, mixture of isomers |
| Moleküler Formülü |
C9H20O4 |
| Molekül Ağırlığı |
192.2527 |
| InChI |
InChI=1/C9H20O4/c1-9(13-7-3-5-11)8-12-6-2-4-10/h9-11H,2-8H2,1H3 |
| CAS kayıt numarası |
24800-44-0 |
| EINECS |
246-466-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.038g/cm3 |
| Kaynama noktası |
316.1°C at 760 mmHg |
| Kırılma indisi |
1.455 |
| Alevlenme noktası |
145°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
|
|
