ChemNet > CAS > 2510-55-6 9-Cyanophenanthrene
2510-55-6 9-Cyanophenanthrene
Ürün Adı |
9-Cyanophenanthrene |
Eş anlamlı |
Cyanophenanthrene; phenanthrene-9-carbonitrile |
Moleküler Formülü |
C15H9N |
Molekül Ağırlığı |
203.2387 |
InChI |
InChI=1/C15H9N/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-9H |
CAS kayıt numarası |
2510-55-6 |
EINECS |
219-725-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.2g/cm3 |
Ergime noktası |
110-112℃ |
Kaynama noktası |
413.8°C at 760 mmHg |
Kırılma indisi |
1.719 |
Alevlenme noktası |
205.4°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21:Harmful by inhalation and in contact with skin.;
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|