ChemNet > CAS > 2510-55-6 9-Cyanophenanthrene
2510-55-6 9-Cyanophenanthrene
| Ürün Adı |
9-Cyanophenanthrene |
| Eş anlamlı |
Cyanophenanthrene; phenanthrene-9-carbonitrile |
| Moleküler Formülü |
C15H9N |
| Molekül Ağırlığı |
203.2387 |
| InChI |
InChI=1/C15H9N/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-9H |
| CAS kayıt numarası |
2510-55-6 |
| EINECS |
219-725-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.2g/cm3 |
| Ergime noktası |
110-112℃ |
| Kaynama noktası |
413.8°C at 760 mmHg |
| Kırılma indisi |
1.719 |
| Alevlenme noktası |
205.4°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
