ChemNet > CAS > 26378-53-0 2-(2-chlorophenoxy)ethylamine
26378-53-0 2-(2-chlorophenoxy)ethylamine
| Ürün Adı |
2-(2-chlorophenoxy)ethylamine |
| Eş anlamlı |
2-Chlorophenoxy-2-ethaneamine; 2-(2-chlorophenoxy)ethanamine |
| Moleküler Formülü |
C8H10ClNO |
| Molekül Ağırlığı |
171.6241 |
| InChI |
InChI=1/C8H10ClNO/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4H,5-6,10H2 |
| CAS kayıt numarası |
26378-53-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.178g/cm3 |
| Kaynama noktası |
266.2°C at 760 mmHg |
| Kırılma indisi |
1.544 |
| Alevlenme noktası |
114.8°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
