ChemNet > CAS > 2642-98-0 6-Aminochrysene
2642-98-0 6-Aminochrysene
| Ürün Adı |
6-Aminochrysene |
| Eş anlamlı |
6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
| Moleküler Formülü |
C18H13N |
| Molekül Ağırlığı |
243.3025 |
| InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
| CAS kayıt numarası |
2642-98-0 |
| EINECS |
220-149-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.253g/cm3 |
| Ergime noktası |
206-211℃ |
| Kaynama noktası |
501.2°C at 760 mmHg |
| Kırılma indisi |
1.813 |
| Alevlenme noktası |
286.9°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
