ChemNet > CAS > 2642-98-0 6-Aminochrysene
2642-98-0 6-Aminochrysene
Ürün Adı |
6-Aminochrysene |
Eş anlamlı |
6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
Moleküler Formülü |
C18H13N |
Molekül Ağırlığı |
243.3025 |
InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
CAS kayıt numarası |
2642-98-0 |
EINECS |
220-149-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.253g/cm3 |
Ergime noktası |
206-211℃ |
Kaynama noktası |
501.2°C at 760 mmHg |
Kırılma indisi |
1.813 |
Alevlenme noktası |
286.9°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|