ChemNet > CAS > 2700-22-3 Benzylidenemalononitrile
2700-22-3 Benzylidenemalononitrile
Ürün Adı |
Benzylidenemalononitrile |
Eş anlamlı |
beta,beta-styrenedicarbonitrile; Benzalmalononitrile; 2-benzylidenemalononitrile; benzylidenepropanedinitrile |
Moleküler Formülü |
C10H6N2 |
Molekül Ağırlığı |
154.168 |
InChI |
InChI=1/C10H6N2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-6H |
CAS kayıt numarası |
2700-22-3 |
EINECS |
220-283-6 |
Moleküler Yapısı |
|
Yoğunluk |
1.154g/cm3 |
Ergime noktası |
82-86℃ |
Kaynama noktası |
294.8°C at 760 mmHg |
Kırılma indisi |
1.612 |
Alevlenme noktası |
138°C |
Tehlike Sembolleri |
T:Toxic;
|
Risk Kodları |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|